|
|
| | 2,3,5-Tri-O-benzyl-D-ribose Basic information |
| Product Name: | 2,3,5-Tri-O-benzyl-D-ribose | | Synonyms: | 2,3,5-TRI-O-BENZYL-D-RIBOFURANOSE;TRI-O-BENZYL-D-RIBOFURANOSE;2,3,5-Tri-O-benzyl-D-ribose;2,3,5-TRI-O-BENZYL-D-RIBOFURANOSETRI-O-BENZYL-D-RIBOFURANOSE;(3R,4R,5R)-3,4-bis(benzyloxy)-5-(benzyloxymethyl)tetrahydrofuran-2-ol;D-Ribose,2,3,5-tris-O-(phenylmethyl)-;(2R,3R,4R)-2,3,5-tris(benzyloxy)-4-hydroxypentanal;2,3,5-Tri-O-benzyl-D-ribofuranose,98% | | CAS: | 54623-25-5 | | MF: | C26H28O5 | | MW: | 420.5 | | EINECS: | 604-383-0 | | Product Categories: | | | Mol File: | 54623-25-5.mol |  |
| | 2,3,5-Tri-O-benzyl-D-ribose Chemical Properties |
| Boiling point | 591.5±50.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | Solid | | pka | 13.28±0.20(Predicted) | | color | Off-white to light yellow | | Water Solubility | Sparingly soluble in water.(0.26 g/L) (25°C), | | InChI | InChI=1S/C26H28O5/c27-16-25(30-18-22-12-6-2-7-13-22)26(31-19-23-14-8-3-9-15-23)24(28)20-29-17-21-10-4-1-5-11-21/h1-16,24-26,28H,17-20H2/t24-,25+,26-/m1/s1 | | InChIKey | XUCNSIRQCBFBHF-UODIDJSMSA-N | | SMILES | O=C[C@@H]([C@@H]([C@@H](COCC1=CC=CC=C1)O)OCC1=CC=CC=C1)OCC1=CC=CC=C1 |
| | 2,3,5-Tri-O-benzyl-D-ribose Usage And Synthesis |
| Uses | It is used as pharmaceutical intermediate. Benzoylthiophenes are allosteric enhancers (AE) of agonist activity at the A1 adenosine receptor. |
| | 2,3,5-Tri-O-benzyl-D-ribose Preparation Products And Raw materials |
|