- H-L-Glu(OEt)-OH
-
- $0.00 / 1kg
-
2026-01-23
- CAS:1119-33-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | H-GLU(OET)-OH Basic information |
| | H-GLU(OET)-OH Chemical Properties |
| Melting point | ~179 °C (dec.) | | Boiling point | 306.47°C (rough estimate) | | density | 1.2843 (rough estimate) | | refractive index | 1.4353 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | solubility | Water (Slightly) | | pka | 2.21±0.10(Predicted) | | form | Powder | | color | White to off-white | | Water Solubility | Soluble in water 100 mg/ml. | | Merck | 14,4470 | | Cosmetics Ingredients Functions | SKIN CONDITIONING HAIR CONDITIONING ANTISTATIC | | InChI | InChI=1S/C7H13NO4/c1-2-12-6(9)4-3-5(8)7(10)11/h5H,2-4,8H2,1H3,(H,10,11)/t5-/m0/s1 | | InChIKey | XMQUEQJCYRFIQS-YFKPBYRVSA-N | | SMILES | C(O)(=O)[C@H](CCC(OCC)=O)N | | LogP | 0.340 (est) | | CAS DataBase Reference | 1119-33-1(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2922.49.4950 |
| | H-GLU(OET)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | L-Glutamic acid 5-ethyl ester is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | H-GLU(OET)-OH Preparation Products And Raw materials |
|