|
|
| | BISMERTHIAZOL Basic information |
| Product Name: | BISMERTHIAZOL | | Synonyms: | 3,4-Thiadiazole-2(3H)-thione,5,5’-(methylenediimino)bis-1;4-thiadiazole-2(3h)-thione,5,5’-(methylenediimino)bis-3;BISMERTHIAZOL;Saikuzuo;Teqingshuang;bismerthianol;5,5'-(Methylenebis(azanediyl))bis(1,3,4-thiadiazole-2(3H)-thione);Yeqingshuang | | CAS: | 79319-85-0 | | MF: | C5H6N6S4 | | MW: | 278.4 | | EINECS: | | | Product Categories: | | | Mol File: | 79319-85-0.mol |  |
| | BISMERTHIAZOL Chemical Properties |
| Melting point | 194-198°C | | Boiling point | 415.4±55.0 °C(Predicted) | | density | 2.12±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 7.20±0.20(Predicted) | | Appearance | White to off-white Solid | | Major Application | agriculture
environmental | | InChI | 1S/C5H6N6S4/c12-4-10-8-2(14-4)6-1-7-3-9-11-5(13)15-3/h1H2,(H,6,8)(H,7,9)(H,10,12)(H,11,13) | | InChIKey | RSNWORHVUOZYLT-UHFFFAOYSA-N | | SMILES | S=C1NN=C(NCNC2=NNC(=S)S2)S1 |
| WGK Germany | WGK 2 | | RTECS | XI4816000 | | Storage Class | 11 - Combustible Solids |
| | BISMERTHIAZOL Usage And Synthesis |
| Chemical Properties | Pure product is white rectangular columnar or light yellow loose powder, mp189～191℃ (industrial product mp172～174℃), decomposition temperature 200℃, easily soluble in dimethylformamide, pyridine, dimethyl sulfoxide, etc. Soluble in methanol, ethanol, acetone, insoluble in benzene, chloroform and water. | | Uses | Bismerthiazol is a high-efficiency, low-toxicity, and low-residue fungicide for the control of bacterial blight in early, middle and late rice seedlings and Honda. | | Synthesis | Bismerthiazol can be prepared by the methods:Put 180kg of hydrazine sulfate, a small amount of catalyst, and 165kg of ammonium thiocyanate into the reactor, heat to reflux, cool, filter, wash with water, and suction filter to obtain dithiourea. |
| | BISMERTHIAZOL Preparation Products And Raw materials |
|