|
|
| | Disodium 1,5-naphthalenedisulfonate Basic information |
| Product Name: | Disodium 1,5-naphthalenedisulfonate | | Synonyms: | 1,5-Naphthalenedisulfonic acid, sodium salt (1:2);SodiuM 1,5-naphthalenedisulfonate d;Disodium 1,5-phthalenedisulfote;Sodium 1,5-naphthalenedisulfonate dibasic technical, ~85% (T);Sodium naphthalene-1,5-disulfonate;1,5-NAPHTHALENEDISULFONIC ACID DISODIUM SALT HYD;Sodium1,5-naphthalenedisulfonate;DISODIUM 1,5-NAPHTHALENEDISULFONATE HYDRATE | | CAS: | 1655-29-4 | | MF: | C10H6Na2O6S2 | | MW: | 332.26 | | EINECS: | 216-732-0 | | Product Categories: | ntermediates of Dyes and Pigments;Intermediates of Dyes and Pigments | | Mol File: | 1655-29-4.mol |  |
| | Disodium 1,5-naphthalenedisulfonate Chemical Properties |
| Boiling point | 300℃[at 101 325 Pa] | | density | 1.82[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | almost transparency in Water | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 113.4g/L at 20℃ | | BRN | 3642373 | | InChI | InChI=1S/C10H8O6S2.Na.H/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;;/h1-6H,(H,11,12,13)(H,14,15,16);; | | InChIKey | JJWUKIQSPZOVKM-UHFFFAOYSA-N | | SMILES | S(C1=CC=CC2=C(C=CC=C12)S(O)(=O)=O)(O)(=O)=O.[NaH] | | LogP | -3.515 | | CAS DataBase Reference | 1655-29-4(CAS DataBase Reference) | | EPA Substance Registry System | 1,5-Naphthalenedisulfonic acid, disodium salt (1655-29-4) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids |
| | Disodium 1,5-naphthalenedisulfonate Usage And Synthesis |
| Chemical Properties | White powder, hygroscopic, exists in the form of hydrates, mainly used as a dye intermediate. | | Uses | Sodium 1,5-Naphthalenedisulfonate is a petroleum disulfonates in crude oil; It is used in the synthesis of Levobunolol Hydrochloride; Also, it is capable of recycling wastewater. | | Flammability and Explosibility | Not classified | | Synthesis | Prepared by sulfonation of naphthalene. | | Purification Methods | Recrystallise it from pKEst aqueous acetone [Okahata et al. J Am Chem Soc 108 2863 1986]. [Beilstein 11 IV 561.] |
| | Disodium 1,5-naphthalenedisulfonate Preparation Products And Raw materials |
|