|
|
| | 4-KETOPIMELIC ACID Basic information |
| | 4-KETOPIMELIC ACID Chemical Properties |
| Melting point | 142-144 °C (lit.) | | Boiling point | 225.11°C (rough estimate) | | density | 1.2311 (rough estimate) | | refractive index | 1.4400 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder, Crystals and/or Chunks | | pka | 4.34±0.17(Predicted) | | color | White to yellow | | BRN | 1708385 | | InChI | InChI=1S/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12) | | InChIKey | UDDSEESQRGPVIL-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCC(=O)CCC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29183000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-KETOPIMELIC ACID Usage And Synthesis |
| Chemical Properties | white fine crystalline powder |
| | 4-KETOPIMELIC ACID Preparation Products And Raw materials |
|