|
|
| | Ethyl 1-Boc-3-piperidinecarboxylate Basic information |
| | Ethyl 1-Boc-3-piperidinecarboxylate Chemical Properties |
| Melting point | 31-35℃ | | Boiling point | 95℃/0.5mm | | density | 1.077±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to lump | | pka | -2.40±0.40(Predicted) | | color | White to Yellow to Orange | | Sensitive | Moisture & Light Sensitive | | BRN | 3614917 | | InChI | InChI=1S/C13H23NO4/c1-5-17-11(15)10-7-6-8-14(9-10)12(16)18-13(2,3)4/h10H,5-9H2,1-4H3 | | InChIKey | YCXCRFGBFZTUSU-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCCC(C(OCC)=O)C1 | | CAS DataBase Reference | 130250-54-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36-43-52 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Sens. 1 |
| | Ethyl 1-Boc-3-piperidinecarboxylate Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Reactant for synthesis of:
- GABAA receptor agonists
- Piperidine derivatives
- Selective TACE inhibitors
- HDL-elevating agents
- α-Sulfonyl hydroxamic acid derivatives
- chemicals in the Iboga-alkaloid family
| | Uses | Reactant for synthesis of:• ;GABAA receptor agonists1• ;Piperidine derivatives2• ;Selective TACE inhibitors3• ;HDL-elevating agents4• ;α-Sulfonyl hydroxamic acid derivatives5• ;chemicals in the Iboga-alkaloid family6 |
| | Ethyl 1-Boc-3-piperidinecarboxylate Preparation Products And Raw materials |
|