|
|
| | 5-Nitroguaiacol sodium salt Basic information |
| Product Name: | 5-Nitroguaiacol sodium salt | | Synonyms: | 2-methoxy-5-nitro;AtonikG;2-methoxy-5-nitrophenolate;2-Methoxy-5-nitrophenol sodium salt Solution, 100ppm;2-Methoxy-5-nitrophenol sodium salt Solution, 1000ppm;nitroguaiacolsodiumsalt;Sodium2-methoxy-5-nitrophenoxide;ATONIK | | CAS: | 67233-85-6 | | MF: | C7H6NNaO4 | | MW: | 191.12 | | EINECS: | 614-038-6 | | Product Categories: | | | Mol File: | 67233-85-6.mol |  |
| | 5-Nitroguaiacol sodium salt Chemical Properties |
| Melting point | 105-106°C | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Sparingly, Heated), Methanol (Slightly) | | form | Solid | | color | Red to Dark Red | | Water Solubility | soluble | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | COLORANT | | InChI | InChI=1S/C7H7NO4.Na/c1-12-7-3-2-5(8(10)11)4-6(7)9;/h2-4,9H,1H3;/q;+1/p-1 | | InChIKey | KBRKFTKQRMYINW-UHFFFAOYSA-M | | SMILES | C1([N+]([O-])=O)C=CC(OC)=C([O-])C=1.[Na+] | | CAS DataBase Reference | 67233-85-6(CAS DataBase Reference) | | EPA Substance Registry System | 2-Methoxy-5-nitrophenol sodium salt (67233-85-6) |
| WGK Germany | WGK 3 | | RTECS | SL7807000 | | HS Code | 2907.19.8000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| | 5-Nitroguaiacol sodium salt Usage And Synthesis |
| Chemical Properties | Sodium 5-nitroguaiacol is soluble in methanol, ethanol, acetone and other organic solvents. It is compounded with sodium o-nitrophenolate and sodium p-nitrophenolate to obtain sodium nitrophenolate, which has been widely used in agriculture. | | Uses | Sodium 5-nitroguaiacol is the most active monomer in sodium nitrophenolate, and has been designated and recommended as a green food engineering plant growth regulator by the United Nations and the Food and Agriculture Organization (FAO). It has a very obvious synergistic effect in the compounding of fertilizers, pesticides, fungicides, and seed coating agents; when applied in animal husbandry and fishery, it can significantly improve the yield and quality of meat, eggs and skins, and also It can enhance the immunity of animals and prevent various diseases. | | Toxicology | The acute oral LD50 of 5-nitroguaiacol sodium on female and male rats was 3100 and 1270 mg/kg, respectively, and had no irritating effect on eyes and skin toxicity too. |
| | 5-Nitroguaiacol sodium salt Preparation Products And Raw materials |
|