|
|
| | TRI-TERT-BUTYL BORATE Basic information |
| Product Name: | TRI-TERT-BUTYL BORATE | | Synonyms: | Tri(1,1-dimethylethoxy)borane;Tri-tert-butyl borate,98%;Tri-tert-butyl borate,Boron tert-butoxide, Tri-tert-butoxyborane;Tri-tert-butyl borate 98%;Boric acid,tris(1,1-dimethylethyl) ester;boricacidtri-tert-butylester;BORON T-BUTOXIDE;TRI-TERT-BUTYL BORATE | | CAS: | 7397-43-5 | | MF: | C12H27BO3 | | MW: | 230.15 | | EINECS: | | | Product Categories: | | | Mol File: | 7397-43-5.mol |  |
| | TRI-TERT-BUTYL BORATE Chemical Properties |
| Melting point | 18-19 °C (lit.) | | Boiling point | 101 °C/74 mmHg (lit.) | | density | 0.811 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.389(lit.) | | Fp | 85 °F | | storage temp. | Flammables area | | form | Liquid | | color | Colorless | | Specific Gravity | 0.811 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C12H27BO3/c1-10(2,3)14-13(15-11(4,5)6)16-12(7,8)9/h1-9H3 | | InChIKey | ZMCWFMOZBTXGKI-UHFFFAOYSA-N | | SMILES | CC(C)(C)OB(OC(C)(C)C)OC(C)(C)C |
| Risk Statements | 10 | | Safety Statements | 16-33 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | TRI-TERT-BUTYL BORATE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | Tri-tert-butyl borate can be used as:
- An additive in the synthesis of chiral α-hydroxy esters by reacting dimethylzinc with α-ketoesters using ()-2-exo-morpholinoisobornane-10-thiol.
- A starting material in the synthesis of boronate of (+)-pinane-2,3-diol.
| | Synthesis Reference(s) | The Journal of Organic Chemistry, 43, p. 2731, 1978 DOI: 10.1021/jo00407a051 | | General Description | Tri-tert-butyl borate is an organoborate commonly used to prepare other borate esters. It is also used as a substrate in Rh-catalyzed carbonylation reactions. |
| | TRI-TERT-BUTYL BORATE Preparation Products And Raw materials |
|