|
|
| | (S)-(-)-1-AMINO-2-(METHOXYMETHYL)PYRROLIDINE Basic information |
| | (S)-(-)-1-AMINO-2-(METHOXYMETHYL)PYRROLIDINE Chemical Properties |
| Boiling point | 42 °C1.8 mm Hg(lit.) | | density | 0.97 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.465(lit.) | | Fp | 162 °F | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | pka | 7.93±0.40(Predicted) | | form | Liquid | | color | Colorless to Almost colorless | | Optical Rotation | [α]20/D 79°, neat | | Water Solubility | sol H2O, ether, dichloromethane. | | BRN | 1523794 | | InChI | InChI=1S/C6H14N2O/c1-9-5-6-3-2-4-8(6)7/h6H,2-5,7H2,1H3/t6-/m0/s1 | | InChIKey | BWSIKGOGLDNQBZ-LURJTMIESA-N | | SMILES | N1(N)CCC[C@H]1COC | | CAS DataBase Reference | 59983-39-0(CAS DataBase Reference) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 10-23 | | HS Code | 29339980 | | Storage Class | 10 - Combustible liquids |
| | (S)-(-)-1-AMINO-2-(METHOXYMETHYL)PYRROLIDINE Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (S)-(-)-1-Amino-2-(methoxymethyl)pyrrolidine is a disubstituted pyrrolidine. (S)-(-)-1-Amino-2-(methoxymethyl)pyrrolidine undergoes condensation reactions with carbonyl compounds to produce hydrazones which are useful for highly enantioselective synthesis. | | Uses | Undergoes condensation reactions with carbonyl compounds to produce hydrazones which are useful synthons in highly enantioselective syntheses. |
| | (S)-(-)-1-AMINO-2-(METHOXYMETHYL)PYRROLIDINE Preparation Products And Raw materials |
|