|
|
| | N-(1-Adamantyl)acetamide Chemical Properties |
| Melting point | 148-149 °C(lit.) | | Boiling point | 329.52°C (rough estimate) | | density | 0.9854 (rough estimate) | | refractive index | 1.4596 (estimate) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 16.16±0.20(Predicted) | | form | Crystalline Powder | | color | White to yellow | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C12H19NO/c1-8(14)13-12-5-9-2-10(6-12)4-11(3-9)7-12/h9-11H,2-7H2,1H3,(H,13,14) | | InChIKey | BCVXYGJCDZPKGV-UHFFFAOYSA-N | | SMILES | C(NC12CC3CC(CC(C3)C1)C2)(=O)C | | CAS DataBase Reference | 880-52-4(CAS DataBase Reference) | | NIST Chemistry Reference | N-(1-adamantyl)acetamide(880-52-4) | | EPA Substance Registry System | Acetamide, N-tricyclo[3.3.1.13,7]dec-1-yl- (880-52-4) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36-24/25-26 | | WGK Germany | 3 | | RTECS | AB4308000 | | TSCA | TSCA listed | | HS Code | 29242998 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | N-(1-Adamantyl)acetamide Usage And Synthesis |
| Acute toxicity | Intraperitoneal-mouse LD50: 520 mg/kg | | Storage | The warehouse is ventilated and dry at low temperature; it is stored separately from food raw materials. | | Chemical Properties | white to light yellow crystal powde | | Uses | A metabolite of Adamantamine | | Purification Methods | Wash the amide well with H2O, dry and recrystallise it from cyclohexane. It is an irritant. [Stetter et al. Chem Ber 92 1629 1959.] |
| | N-(1-Adamantyl)acetamide Preparation Products And Raw materials |
|