| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
2-(2-Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid manufacturers
|
| | 2-(2-Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid Basic information |
| Product Name: | 2-(2-Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid | | Synonyms: | 2-(2-Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid;2-{[(2-Carboxyethyl)sulfanylthiocarbonyl]sulfanyl}propanoic Acid;3-((((1-Carboxyethyl)Thio)Carbonothioyl)Thio)Propanoic Acid;Propanoic acid, 2-[[[(2-carboxyethyl)thio]thioxomethyl]thio]-;2-[[[(2-Carboxyethyl)thio]thioxomethyl]thio]propanoic acid;82-(2-Carboxyethylthioalkylthiocarbonylthioalkyl)propionic acid | | CAS: | 870451-09-5 | | MF: | C7H10O4S3 | | MW: | 254.35 | | EINECS: | | | Product Categories: | | | Mol File: | 870451-09-5.mol |  |
| | 2-(2-Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid Chemical Properties |
| Melting point | 120-125 °C | | Boiling point | 528.8±43.0 °C(Predicted) | | density | 1.526±0.06 g/cm3(Predicted) | | pka | 2.90±0.10(Predicted) | | form | powder | | InChIKey | IKWGMGMZWODWEO-UHFFFAOYSA-N | | SMILES | S(C(C)C(=O)O)C(=S)SCCC(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(2-Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid Usage And Synthesis |
| Uses | 3-((((1-Carboxyethyl)Thio)Carbonothioyl)Thio)Propanoic Acid is a useful research chemical compound used as a reactant in the synthesis and evaluation of new dicarboxylic acid functional trithiocarbonate RAFT agent. | | General Description | - A stable, trithiocarbonate chain transfer agent (CTA), also referred to as a RAFT agent, which can control chain growth in free radical polymerization producing polymers with well-defined molecular weights and low polydispersities.
- 2-(2-Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid may be used to control homo- and co-polymerization of acrylic acid, acrylates, acrylamides, styrenes, methacrylates, and methacrylamides. It is soluble in aqueous and organic media (amphiphilic).
|
| | 2-(2-Carboxyethylsulfanylthiocarbonylsulfanyl)propionic acid Preparation Products And Raw materials |
|