2-Chloro-5-pyrrol-1-yl-benzoic acid manufacturers
- NB-64
-
- $2500.00
-
2026-05-11
- CAS:53242-68-5
- Purity:
- Supply Ability: 10g
|
| | 2-Chloro-5-pyrrol-1-yl-benzoic acid Basic information |
| Product Name: | 2-Chloro-5-pyrrol-1-yl-benzoic acid | | Synonyms: | TIMTEC-BB SBB011483;2-chloro-5-(1H-pyrrol-1-yl)benzoic acid;Benzoic acid, 2-chloro-5-(1H-pyrrol-1-yl)-;NB-64;NB 64,NB64;2-Chloro-5-pyrrol-1-yl-benzoic acid | | CAS: | 53242-68-5 | | MF: | C11H8ClNO2 | | MW: | 221.64 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Chloro-5-pyrrol-1-yl-benzoic acid Chemical Properties |
| form | solid | | InChI | 1S/C11H8ClNO2/c12-10-4-3-8(7-9(10)11(14)15)13-5-1-2-6-13/h1-7H,(H,14,15) | | InChIKey | HPAOLHCBQKYITR-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(ccc1Cl)-n2cccc2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2-Chloro-5-pyrrol-1-yl-benzoic acid Usage And Synthesis |
| | 2-Chloro-5-pyrrol-1-yl-benzoic acid Preparation Products And Raw materials |
|