| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
THPN manufacturers
- THPN
-
- $1520.00
-
2026-05-11
- CAS:100079-26-3
- Purity:
- Supply Ability: 10g
|
| Product Name: | THPN | | Synonyms: | 1-(3,4,5-Trihydroxyphenyl)-1-nonanone;THPN;1-Nonanone, 1-(3,4,5-trihydroxyphenyl)-;THPN >=98% (HPLC);1-(3,4,5-trihydroxyphenyl)nonan-1-one | | CAS: | 100079-26-3 | | MF: | C15H22O4 | | MW: | 266.33 | | EINECS: | | | Product Categories: | | | Mol File: | 100079-26-3.mol |  |
| storage temp. | 2-8°C | | solubility | Soluble in DMSO | | form | powder | | color | white to beige | | InChI | 1S/C15H22O4/c1-2-3-4-5-6-7-8-12(16)11-9-13(17)15(19)14(18)10-11/h9-10,17-19H,2-8H2,1H3 | | InChIKey | NVFRHTFJDGAFQS-UHFFFAOYSA-N | | SMILES | OC1=C(O)C(O)=CC(C(CCCCCCCC)=O)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Uses | THPN is a Nur77 agonist. THPN binds Nur77 and promotes translocation of the receptor to the mitochondria resulting in autophagy in melanoma cell lines. | | General Description | THPN or 1-(3,4,5-Trihydroxyphenyl)nonan-1-one, is a derivative of cytosporone B. | | Biochem/physiol Actions | THPN is potent nuclear receptor TR3 (Nur77) antagonist that induces autophagic cell death in melanoma. Co-application of THPN with Akt2 inhibitors significantly represses tumor growth in xenograft mouse model. | | IC 50 | Nur77/NR4A1 |
| | THPN Preparation Products And Raw materials |
|