EXO-2,3-EPOXYNORBORNANE manufacturers
- EXO-2,3-EPOXYNORBORNANE
-
- $0.00 / 25KG
-
2025-12-01
- CAS:3146-39-2
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | EXO-2,3-EPOXYNORBORNANE Basic information |
| Product Name: | EXO-2,3-EPOXYNORBORNANE | | Synonyms: | exo-2,3-Epoxynorbornane 97%;3-epoxy-exo-norbornan;3-Oxatricyclo(3.2.1.0(2,4))octane, exo-;3-Oxatricyclo[3.2.1.0(2,4)]octane, (1alpha,2beta,4beta,5alpha)-;3-Oxatricyclo[3.2.1.0(sup2,4)]octane, exo-;4))octane,(1-alpha,2-beta,4-beta,5-alpha)-3-oxatricyclo(3.2.1.0(sup;exo-2,3-Oxidonorbornane;exo-2,exo-3-Epoxybicyclo[2.2.1]heptane | | CAS: | 3146-39-2 | | MF: | C7H10O | | MW: | 110.15 | | EINECS: | 221-558-3 | | Product Categories: | Epoxide Monomers;Alicyclic/Etch-Resistant MonomersPolymer Science;Lithography Monomers;Monomers;Self Assembly&Contact Printing | | Mol File: | 3146-39-2.mol |  |
| | EXO-2,3-EPOXYNORBORNANE Chemical Properties |
| Melting point | 122-124 °C (lit.) | | Boiling point | 166.47°C (rough estimate) | | density | 0.9409 (rough estimate) | | refractive index | 1.4409 (estimate) | | Fp | 50 °F | | form | solid | | InChI | 1S/C7H10O/c1-2-5-3-4(1)6-7(5)8-6/h4-7H,1-3H2/t4-,5+,6+,7- | | InChIKey | OHNNZOOGWXZCPZ-RNGGSSJXSA-N | | SMILES | C1C[C@H]2C[C@@H]1[C@@H]3O[C@H]23 |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-27-33-36/37/39 | | RIDADR | UN 1325 4.1/PG 3 | | WGK Germany | 3 | | RTECS | RB7176000 | | HazardClass | 4.1 | | PackingGroup | II | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 1 |
| | EXO-2,3-EPOXYNORBORNANE Usage And Synthesis |
| Uses | exo-?2,?3-?Epoxynorbornane is a cytotoxic epoxide compound which also may act as a mutagen. |
| | EXO-2,3-EPOXYNORBORNANE Preparation Products And Raw materials |
|