|
|
| | ESAX-003 Basic information |
| Product Name: | ESAX-003 | | Synonyms: | ESAX-003;Benzenebutanoic acid, α-cyano-β-methyl-γ-oxo-2-(trifluoromethyl)-, ethyl ester;Esaxerenone Impurity 4;Ethyl 2-cyano-3-methyl-4-oxo-4-(2-(trifluoromethyl)phenyl)butanoate | | CAS: | 1631030-74-4 | | MF: | C15H14F3NO3 | | MW: | 313.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1631030-74-4.mol |  |
| | ESAX-003 Chemical Properties |
| Boiling point | 435.6±45.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C15H14F3NO3/c1-3-22-14(21)11(8-19)9(2)13(20)10-6-4-5-7-12(10)15(16,17)18/h4-7,9,11H,3H2,1-2H3 | | InChIKey | HELONCRAXULTEB-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1C(F)(F)F)(=O)C(C)C(C#N)C(=O)OCC |
| | ESAX-003 Usage And Synthesis |
| | ESAX-003 Preparation Products And Raw materials |
|