| Company Name: |
Shaanxi Didu New Materials Co. Ltd
|
| Tel: |
+86-86-17392712779 +8617392712697 |
| Email: |
1022@dideu.com |
| Products Intro: |
Product Name:Formalin;cis-Stilbene oxide
CAS:1689-71-0
Purity:0.99 Package:25KG,200L
|
|
| | CIS-STILBENE OXIDE Basic information |
| Product Name: | CIS-STILBENE OXIDE | | Synonyms: | Oxirane, 2,3-diphenyl-, cis-;Oxirane,cis-2,3-diphenyl-;cis-2,3-diphenyloxirane;(2R,3S)-2,3-Diphenyloxirane;(2S,3R)-2,3-Diphenyloxirane;meso-Stilbene oxide;Bibenzyl, .alpha.,.alpha.'-epoxy-, cis-;Nsc133513 | | CAS: | 1689-71-0 | | MF: | C14H12O | | MW: | 196.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1689-71-0.mol |  |
| | CIS-STILBENE OXIDE Chemical Properties |
| Melting point | 38-40 °C (lit.) | | Boiling point | 126-132 °C(Press: 4 Torr) | | density | 1.136±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | BRN | 82737 | | Stability: | Stable, but may be air sensitive - store under nitrogen. Incompatible with acids, bases, oxidizing agents. | | InChI | 1S/C14H12O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+ | | InChIKey | ARCJQKUWGAZPFX-OKILXGFUSA-N | | SMILES | O1[C@H]([C@H]1c2ccccc2)c3ccccc3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CIS-STILBENE OXIDE Usage And Synthesis |
| Chemical Properties | solid | | Definition | ChEBI: Cis-stilbene oxide is a stilbene oxide. |
| | CIS-STILBENE OXIDE Preparation Products And Raw materials |
|