- 2,3-Difluoropyridine
-
- $1.10 / 1g
-
2025-06-25
- CAS:1513-66-2
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
- 2,3-Difluoropyridine
-
- $10.00 / 1KG
-
2021-10-16
- CAS:1513-66-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 Tons
- 2,3-Difluoropyridine
-
- $1.00 / 1KG
-
2019-12-31
- CAS:1513-66-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 2,3-Difluoropyridine Basic information |
| Product Name: | 2,3-Difluoropyridine | | Synonyms: | 2,3-DIFLUOROPYRIDINE;2,3-Difluoropyridine 97%;2,3-Difluoropyridine97%;2,3-Difluoropyridine ,98%;2,3-difluorpyridine;2,3-DIFLUOROPYRIDINE(RS20007306);2,3-Difluoropyridine>Pyridine, 2,3-difluoro- | | CAS: | 1513-66-2 | | MF: | C5H3F2N | | MW: | 115.08 | | EINECS: | | | Product Categories: | Building Blocks;C5;C5 to C6;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Heterocyclic Fluorinated Building Blocks;Other Fluorinated Heterocycles;Pyridines;Pyridine;Fluorin-contained pyridine series | | Mol File: | 1513-66-2.mol |  |
| | 2,3-Difluoropyridine Chemical Properties |
| Boiling point | 125-126°C | | density | 1.265 g/mL at 25 °C | | refractive index | n20/D 1.427 | | Fp | 125-126°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Chloroform, Methanol | | pka | -2.85±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C5H3F2N/c6-4-2-1-3-8-5(4)7/h1-3H | | InChIKey | OGVLEPMNNPZAPS-UHFFFAOYSA-N | | SMILES | C1(F)=NC=CC=C1F | | CAS DataBase Reference | 1513-66-2(CAS DataBase Reference) |
| Hazard Codes | T,F,Xi,N,Xn | | Risk Statements | 10-36/37/38-50-41-22 | | Safety Statements | 26-36/37/39-36/37-61-45-25-16 | | RIDADR | 1993 | | WGK Germany | 2 | | Hazard Note | Toxic | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 Flam. Liq. 3 |
| | 2,3-Difluoropyridine Usage And Synthesis |
| Chemical Properties | Pale yellow liquid | | Uses | 2,3-Difluoropyridine is an intermediate used in the preparation of 2,7-diazaspiro[4.5]decan-1-one derivatives as 11-b hydroxysteroid dehydrogenase type 1 inhibitors and mineralocorticoid receptor antagonists. |
| | 2,3-Difluoropyridine Preparation Products And Raw materials |
|