|
|
| | Methyl 5-bromo-2-chloro-3-nitrobenzoate Basic information |
| Product Name: | Methyl 5-bromo-2-chloro-3-nitrobenzoate | | Synonyms: | Methyl 5-bromo-2-chloro-3-nitrobenzoate;Methyl 2-chloro-5-bromo-3-nitrobenzoic acid;XVVAOPFGJSBHMS-UHFFFAOYSA-N;methyl 2,5-dibromo-3-nitrobenzoate;Benzoic acid, 5-bromo-2-chloro-3-nitro-, methyl ester;2-chloro-3-nitro-5-bromobenzoic acid methyl ester | | CAS: | 124371-59-1 | | MF: | C8H5BrClNO4 | | MW: | 294.49 | | EINECS: | | | Product Categories: | | | Mol File: | 124371-59-1.mol |  |
| | Methyl 5-bromo-2-chloro-3-nitrobenzoate Chemical Properties |
| Boiling point | 353.5±37.0 °C(Predicted) | | density | 1.760±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C8H5BrClNO4/c1-15-8(12)5-2-4(9)3-6(7(5)10)11(13)14/h2-3H,1H3 | | InChIKey | XVVAOPFGJSBHMS-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(Br)=CC([N+]([O-])=O)=C1Cl |
| | Methyl 5-bromo-2-chloro-3-nitrobenzoate Usage And Synthesis |
| | Methyl 5-bromo-2-chloro-3-nitrobenzoate Preparation Products And Raw materials |
|