3'-Deoxyneamine manufacturers
- Nebramine
-
-
2025-12-19
- CAS:34051-04-2
- Min. Order: 10mg
- Purity: 90%+
- Supply Ability: 10g
|
| | 3'-Deoxyneamine Basic information |
| Product Name: | 3'-Deoxyneamine | | Synonyms: | 3'-Deoxyneamine;D-Streptamine, 2-deoxy-4-O-(2,6-diamino-2,3,6-trideoxy-α-D-ribo-hexopyranosyl)-;Tobramycin Impurity 2 (Tobramycin EP Impurity B) (Nebramine);(1S,2R,3R,4S,6R)-4,6-diamino-3-(((2R,3R,5S,6R)-3-amino-6-(aminomethyl)-5-hydroxytetrahydro-2H-pyran-2-yl)oxy)cyclohexane-1,2-diol;Rac-Nebramine;Tobramycin EP Impurity B;Nebramine
Regular;2-deoxy-4-O-(2,6-diamino-2,3,6-trideoxy-α-D-ribo-hexopyranosyl)-D-streptamine (nebramine) | | CAS: | 34051-04-2 | | MF: | C12H26N4O5 | | MW: | 306.36 | | EINECS: | | | Product Categories: | | | Mol File: | 34051-04-2.mol |  |
| | 3'-Deoxyneamine Chemical Properties |
| Boiling point | 540.1±50.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | -10 to -25°C | | solubility | Water (Slightly, Sonicated) | | form | Solid | | pka | 13+-.0.70(Predicted) | | color | White to Dark Brown | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C12H26N4O5/c13-3-8-7(17)2-6(16)12(20-8)21-11-5(15)1-4(14)9(18)10(11)19/h4-12,17-19H,1-3,13-16H2 | | InChIKey | QBWLTQZEVUXXSR-UHFFFAOYSA-N | | SMILES | O(C1C(CC(O)C(CN)O1)N)C1C(CC(N)C(O)C1O)N |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | 3'-Deoxyneamine Usage And Synthesis |
| Uses | Nebramine Sulfate is a degradation product on the antibiotic Tobramycin (T524000). | | Definition | ChEBI: Nebramine is a glycoside and an amino cyclitol. |
| | 3'-Deoxyneamine Preparation Products And Raw materials |
|