- 5-Chloroindoline
-
- $0.00 / 1kg
-
2025-04-04
- CAS:25658-80-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- 5-Chloroindoline
-
- $7.00 / 1KG
-
2020-01-01
- CAS:25658-80-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | 5-Chloroindoline Basic information |
| Product Name: | 5-Chloroindoline | | Synonyms: | 5-Chloroindoline 97%;5-Chloroindoline 5-Chloro-2,3-dihydro-(1H)-indole in stock Factory;TIMTEC-BB SBB010106;5-CHLOROINDOLINE;5-CHLORO-2,3-DIHYDRO-(1H)-INDOLE;1H-Indole, 5-chloro-2,3-dihydro- | | CAS: | 25658-80-4 | | MF: | C8H8ClN | | MW: | 153.61 | | EINECS: | 247-167-8 | | Product Categories: | Indoline & Oxindole | | Mol File: | 25658-80-4.mol |  |
| | 5-Chloroindoline Chemical Properties |
| Boiling point | 93-98°C 0,3mm | | density | 1.214±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | liquid | | pka | 4.48±0.20(Predicted) | | color | Clear, colourless | | InChI | InChI=1S/C8H8ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5,10H,3-4H2 | | InChIKey | YMCIVAPEOZDEGH-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Cl)C=C2)CC1 | | CAS DataBase Reference | 25658-80-4(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 25-51 | | Safety Statements | 24/25-45 | | RIDADR | UN2811 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 5-Chloroindoline Usage And Synthesis |
| | 5-Chloroindoline Preparation Products And Raw materials |
|