| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,3-Dichloro-2-fluorobenzene Basic information |
| Product Name: | 1,3-Dichloro-2-fluorobenzene | | Synonyms: | 1,3-Dichloro-2-fluor;1,3-Dicchloro-2-fluorobenzene;1,3-DICHLORO-2-FLUOROBENZENE;Benzene,1,3-dichloro-2-fluoro-;2,6-DichloroFluorobenzene99%;2,6-Dichloro Fluorobenzene 99%;1,3-Dichloro-2-fluorobenzene, 98+%;2,6-dichloro-1-fluorobenzene | | CAS: | 2268-05-5 | | MF: | C6H3Cl2F | | MW: | 164.99 | | EINECS: | 607-128-1 | | Product Categories: | Halogenated Hydrocarbons;Aryl;C6 | | Mol File: | 2268-05-5.mol |  |
| | 1,3-Dichloro-2-fluorobenzene Chemical Properties |
| Melting point | 37-40 °C(lit.) | | Boiling point | 168-169 °C(lit.) | | density | 1.3967 (estimate) | | Fp | 140 °F | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Light orange | | BRN | 1862513 | | InChI | InChI=1S/C6H3Cl2F/c7-4-2-1-3-5(8)6(4)9/h1-3H | | InChIKey | JORVCRLRRRRLFI-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(Cl)=C1F | | CAS DataBase Reference | 2268-05-5(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3-Dichloro-2-fluorobenzene(2268-05-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 2 | | Hazard Note | Irritant | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 2903998090 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Dichloro-2-fluorobenzene Usage And Synthesis |
| Chemical Properties | slightly beige transparent crystals | | Uses | 1,3-Dichloro-2-fluorobenzene is used as an intermediate in pharmaceuticals, pesticides, dyes and liquid crystal materials, and is an intermediate for antibacterial agents such as norfloxacin, lomefloxacin and terfluridine. | | Synthesis | The general procedure for the synthesis of 2,6-dichlorofluorobenzene from 3-chloro-2-fluoronitrobenzene is as follows: In a 250 ml four-necked flask, 240 g (1.368 mol) of 3-chloro-2-fluoronitrobenzene was added and the temperature was raised to 180°C. Dry chlorine gas was passed through the flask, and the temperature of the reaction was controlled to be between 180 and 190°C. The reaction was carried out by distillation. Distillation was carried out during the reaction for 8 to 10 hours. The fractions are collected and sequentially washed with water and alkali to a weak base. The organic phase was separated and subjected to vacuum distillation, resulting in 210 g of 2,6-dichlorofluorobenzene with 99.7% purity and 93% yield. | | References | [1] Patent: CN102249881, 2016, B. Location in patent: Paragraph 0015; 0050-0051 |
| | 1,3-Dichloro-2-fluorobenzene Preparation Products And Raw materials |
| Raw materials | Fluoroboric acid-->2,3-Dichlorofluorobenzene-->2,3-Difluorochlorobenzene-->1-Bromo-2,6-dichlorobenzene-->2-Chloro-1,3-difluorobenzene-->3-Chloro-2-fluoronitrobenzene-->1,2-Difluorobenzene-->3,5-dichloro-4-fluoroaniline-->3,4,5-Trichloronitrobenzene-->3,5-Dichloro-4-fluoronitrobenzene-->2,6-Dichloroaniline-->1,2-Dichlorobenzene-->2,3-Dichloronitrobenzene-->1,2,3-Trichlorobenzene | | Preparation Products | 1,2,3-Trifluorobenzene-->Acetic acid, 2-(2,3,4-trifluorophenoxy)- |
|