|
|
| | 2-Amino-5-(2-methoxy-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester Basic information |
| Product Name: | 2-Amino-5-(2-methoxy-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester | | Synonyms: | Ethyl 2-amino-5-{[(2-methoxyphenyl)amino]-carbonyl}-4-methylthiophene-3-carboxyla;ethyl 2-amino-5-{[(2-methoxyphenyl)amino]carbonyl}-4-methylthiophene-3-carboxylate;2-amino-5-[[(2-methoxyphenyl)amino]-oxomethyl]-4-methyl-3-thiophenecarboxylic acid ethyl ester;OTAVA-BB BB7013050646;AURORA 20465;BAS 01856113;BIM-0028925.P001;CBMicro_029006 | | CAS: | 332867-79-5 | | MF: | C16H18N2O4S | | MW: | 334.39 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Amino-5-(2-methoxy-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 456.9±45.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | form | solid | | pka | 11.41±0.70(Predicted) | | InChI | 1S/C16H18N2O4S/c1-4-22-16(20)12-9(2)13(23-14(12)17)15(19)18-10-7-5-6-8-11(10)21-3/h5-8H,4,17H2,1-3H3,(H,18,19) | | InChIKey | JEZBCBFVAXJLDN-UHFFFAOYSA-N | | SMILES | O=C(NC1=CC=CC=C1OC)C2=C(C)C(C(OCC)=O)=C(N)S2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-Amino-5-(2-methoxy-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester Usage And Synthesis |
| | 2-Amino-5-(2-methoxy-phenylcarbamoyl)-4-methyl-thiophene-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|