- BOC-D-2-THIENYLALANINE
-
- $1.00 / 1kg
-
2019-07-06
- CAS:78452-55-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | BOC-D-2-THIENYLALANINE Basic information |
| Product Name: | BOC-D-2-THIENYLALANINE | | Synonyms: | N-(tert-Butoxycarbonyl)-3-(2-thienyl)-D-alanine;(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoate;BOC-3-D-ALA(2-THIENYL)-OH;BOC-BETA-(2-THIENYL)-D-ALANINE;BOC-D-ALA(2-THIENYL)-OH;BOC-D-2-THIENYLALANINE;BOC-D-THI-OH;BOC-3-(2-THIENYL)-D-ALANINE;;BOC-D-2-THI;(2R)-2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]-3-thiophen-2-ylpropanoate;(R)-N-BOC-2-THIENYLALANINE, 95%, 98% EE;(R)-N-BOC-2-ThienylalanineN-tert-Butoxycarbonyl-2-thienyl-D-alanine;(2R)-2-{[(tert-butoxy)carbonyl]aMino}-3-(thiophen-2-yl)propanoic acid | | CAS: | 78452-55-8 | | MF: | C12H17NO4S | | MW: | 271.33 | | EINECS: | | | Product Categories: | a-amino;Phenylalanine analogs and other aromatic alpha amino acids;Amino Acids | | Mol File: | 78452-55-8.mol |  |
| | BOC-D-2-THIENYLALANINE Chemical Properties |
| Boiling point | 431.5±40.0 °C(Predicted) | | density | 1.2791 (rough estimate) | | refractive index | 1.6280 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | pka | 3.70±0.10(Predicted) | | Major Application | peptide synthesis | | InChI | InChI=1/C12H17NO4S/c1-12(2,3)17-11(16)13-9(10(14)15)7-8-5-4-6-18-8/h4-6,9H,7H2,1-3H3,(H,13,16)(H,14,15)/t9-/s3 | | InChIKey | OJLISTAWQHSIHL-DJEYLCQNNA-N | | SMILES | [C@@H](C(=O)O)(NC(=O)OC(C)(C)C)CC1SC=CC=1 |&1:0,r| | | CAS DataBase Reference | 78452-55-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29223900 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | BOC-D-2-THIENYLALANINE Usage And Synthesis |
| Chemical Properties | off-white to beige crystalline powder | | Uses | (R)-N-Boc-2-Thienylalanine, is an alanine derivative, used in various chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-D-2-THIENYLALANINE Preparation Products And Raw materials |
|