|
|
| | 2-(2-AMINOPHENYL)BENZIMIDAZOLE Basic information |
| | 2-(2-AMINOPHENYL)BENZIMIDAZOLE Chemical Properties |
| Melting point | 211-215 °C(lit.) | | Boiling point | 460.1±47.0 °C(Predicted) | | density | 1.286±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 11.30±0.10(Predicted) | | color | Light Brown | | Water Solubility | Insoluble in water. | | BRN | 173018 | | InChI | InChI=1S/C13H11N3/c14-10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13/h1-8H,14H2,(H,15,16) | | InChIKey | YWNXHTNWOQHFRL-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC=C1C1NC2=CC=CC=C2N=1 | | CAS DataBase Reference | 5805-39-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-36/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 2-(2-AMINOPHENYL)BENZIMIDAZOLE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2-(2-Aminophenyl)benzimidazole is used as pharmaceutical intermediate. | | Definition | ChEBI: 2-(1H-benzimidazol-2-yl)aniline is a member of the class of benzimidazoles that is 1H-benzimidazole substituted by a 2-aminophenyl group at position 2. It has a role as a geroprotector. It is a member of benzimidazoles, a substituted aniline and a primary arylamine. |
| | 2-(2-AMINOPHENYL)BENZIMIDAZOLE Preparation Products And Raw materials |
|