| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Z-Arg(Pbf)-OH cha Basic information |
| Product Name: | Z-Arg(Pbf)-OH cha | | Synonyms: | N-ALPHA-CARBOBENZOXY-N-(OMEGA-2,2,4,6,7-PENTAMETHYL DIHYDROBENZOFURAN-5-SULFONYL)-L-ARGININE CYCLOHEXYLAMMONIUM SALT;N-ALPHA-Z-N-OMEGA-(2,2,4,6,7-PENTAMETHYLDIHYDROBENZOFURAN-5-SULFONYL)-L-ARGININE CYCLOHEXYLAMINE SALT;Z-N-OMEGA-(2,2,4,6,7-PENTAMETHYLDIHYDROBENZOFURAN-5-SULFONYL)-L-ARGININE CYCLOHEXYLAMMONIUM SALT;Z-ARGININE(PBF)-OH CHA;Nα-Z-Nω-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-L-arginine cyclohexylammonium salt;Z-Arg(Pbf)-OH cyclohexylammonium salt;Z-Arg(Pbf)-OH cha | | CAS: | | | MF: | C33H49N5O7S | | MW: | 659.84 | | EINECS: | | | Product Categories: | Z-Amino Acids and Derivatives;Z-Amino acid series | | Mol File: | Mol File |  |
| | Z-Arg(Pbf)-OH cha Chemical Properties |
| storage temp. | -20°C | | form | powder | | Major Application | peptide synthesis | | InChIKey | VDQHDVIYBBISOZ-BOXHHOBZSA-N | | SMILES | NC1CCCCC1.Cc2c(C)c(c(C)c3CC(C)(C)Oc23)S(=O)(=O)NC(=N)NCCC[C@H](NC(=O)OCc4ccccc4)C(O)=O |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | Z-Arg(Pbf)-OH cha Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-Arg(Pbf)-OH cha Preparation Products And Raw materials |
|