2-(4-NITROPHENYL)BUTYRIC ACID manufacturers
|
| | 2-(4-NITROPHENYL)BUTYRIC ACID Basic information |
| Product Name: | 2-(4-NITROPHENYL)BUTYRIC ACID | | Synonyms: | 2-(p-nitrophenyl)-butyricaci;2-(p-nitrophenyl)butyricacid;alpha-ethyl-4-nitro-benzeneaceticaci;alpha-ethyl-4-nitrobenzeneaceticacid;ALPHA-ETHYL-4-NITROPHENYLACETIC ACID;A-ETHYL-4-NITROBENZONIC ACID;2-(4-NITROPHENYL)BUTYRIC ACID;α-(p-Nitro-phenyl)butyric acid | | CAS: | 7463-53-8 | | MF: | C10H11NO4 | | MW: | 209.2 | | EINECS: | 231-256-3 | | Product Categories: | | | Mol File: | 7463-53-8.mol |  |
| | 2-(4-NITROPHENYL)BUTYRIC ACID Chemical Properties |
| Melting point | 122-123 °C | | Boiling point | 371.2±25.0 °C(Predicted) | | density | 1.287±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.91±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H11NO4/c1-2-9(10(12)13)7-3-5-8(6-4-7)11(14)15/h3-6,9H,2H2,1H3,(H,12,13) | | InChIKey | XBGNOMBPRQVJSR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C1=CC=C([N+]([O-])=O)C=C1)CC |
| | 2-(4-NITROPHENYL)BUTYRIC ACID Usage And Synthesis |
| Chemical Properties | Crystallizes. Melting point 121-122°C. | | Uses | 2-(4-Nitrophenyl)butyric acid is a key intermediate in the synthesis of indobufen, a new generation of anti-platelet aggregation agents. | | Synthesis | Synthesis of 2-(4-nitrophenyl)butyric acid, using α-phenylbutyronitrile as the starting material, to produce 2-(4-nitrophenyl)butyronitrile by nitration reaction, and then by hydrolysis reaction to produce 2-(4-nitrophenyl)butyric acid. |
| | 2-(4-NITROPHENYL)BUTYRIC ACID Preparation Products And Raw materials |
|