|
|
| | 2-(4-Aminopentyl(ethyl)amino)ethanol Basic information |
| Product Name: | 2-(4-Aminopentyl(ethyl)amino)ethanol | | Synonyms: | Hydroxynovaldiamine;2-((4-Aminopentyl)(ethyl)amino)ethano;2-((4-Amin2-((4-Aminopentyl)(ethyl)amino)ethanol;2-(4-Aminopentyl(et2-(4-Aminopentyl(ethyl)amino)ethanolhyl)amino)ethanol;Hydroxychloroquine Sulfate Impurity 8;6-amino-2-(ethylamino)-1-heptanol;HYDROXYNOVOLDIAMINE;2-(4-aminopentyl(ethyl)amino)ethanol | | CAS: | 69559-11-1 | | MF: | C9H22N2O | | MW: | 174.28 | | EINECS: | 274-039-9 | | Product Categories: | | | Mol File: | 69559-11-1.mol |  |
| | 2-(4-Aminopentyl(ethyl)amino)ethanol Chemical Properties |
| Boiling point | 93 °C(Press: 0.6 Torr) | | density | 0.935 | | refractive index | 1.470-1474 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 14.76±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H22N2O/c1-3-11(7-8-12)6-4-5-9(2)10/h9,12H,3-8,10H2,1-2H3 | | InChIKey | XUVXSSOPXQRCGL-UHFFFAOYSA-N | | SMILES | C(O)CN(CCCC(N)C)CC | | CAS DataBase Reference | 69559-11-1(CAS DataBase Reference) |
| RIDADR | UN2735 | | HazardClass | 8 |
| | 2-(4-Aminopentyl(ethyl)amino)ethanol Usage And Synthesis |
| Uses | 2-(4-Aminopentyl(ethyl)amino)ethanol is a colorless and pure liquid that can be used as a pharmaceutical intermediate. |
| | 2-(4-Aminopentyl(ethyl)amino)ethanol Preparation Products And Raw materials |
|