| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | S(-)-BACLOFEN HCL Basic information |
| Product Name: | S(-)-BACLOFEN HCL | | Synonyms: | beta-(aminomethyl)-4-chloro-,hydrochloride,(s)-benzenepropanoicaci;beta-(aminomethyl)-p-chloro-,hydrochloride,(s)-hydrocinnamicaci;l-baclofenhydrochloride;s(-)-β-(aminomethyl)-4-chlorobenzenepropanoic acid hydrochloride;S(-)-BACLOFENHYDROCHLORIDE(FORR&DONLY);S(-)-BACLOFEN HCL;(-)-baclofenhydrochloride;(-)-s-3-(p-chlorophenyl)-4-aminobutanoicacidhydrochloride | | CAS: | 63701-56-4 | | MF: | C10H13Cl2NO2 | | MW: | 250.12172 | | EINECS: | | | Product Categories: | | | Mol File: | 63701-56-4.mol |  |
| | S(-)-BACLOFEN HCL Chemical Properties |
| Melting point | 194-195 °C(Solv: methanol (67-56-1)) | | solubility | DMSO: >20 mg/mL | | form | solid | | color | white | | Optical Rotation | [α]28/D 2.2°, c = 0.9 in methanol(lit.) | | InChI | 1S/C10H12ClNO2.ClH/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14;/h1-4,8H,5-6,12H2,(H,13,14);1H/t8-;/m1./s1 | | InChIKey | WMNUVYYLMCMHLU-DDWIOCJRSA-N | | SMILES | Cl[H].NC[C@@H](CC(O)=O)c1ccc(Cl)cc1 |
| RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | MW5084400 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
| | S(-)-BACLOFEN HCL Usage And Synthesis |
| Uses | S(-)-Baclofen Hydrochloride is a GABAB receptor agonist. Also, it is an effective antagonist of muscimol. | | Biochem/physiol Actions | S()-Baclofen hydrochloride is a less active enantiomer of baclofen. |
| | S(-)-BACLOFEN HCL Preparation Products And Raw materials |
|