|
|
| | (-)-Diisopropyl O,O'-bis(trimethylsilyl) -D-tartrate Basic information |
| Product Name: | (-)-Diisopropyl O,O'-bis(trimethylsilyl) -D-tartrate | | Synonyms: | Reaxys ID: 18617173;DIISOPROPYL O O'-BIS(TRIMETHYLSILYL-D- &;(-)-o,o'-bis(trimethylsilyl)-d-tartaric acid diisopropyl ester;(-)-DIISOPROPYL O,O-BIS(TRIMETHYLSILYL) -D-TARTRATE;diisopropyl (2S,3S)-2,3-bis((trimethylsilyl)oxy)succinate;Butanedioic acid, 2,3-bis[(trimethylsilyl)oxy]-, 1,4-bis(1-methylethyl) ester, (2S,3S)-;(?)-Diisopropyl-O,O′-bis(trimethylsilyl)-D-tartrate | | CAS: | 197013-45-9 | | MF: | C16H34O6Si2 | | MW: | 378.61 | | EINECS: | | | Product Categories: | | | Mol File: | 197013-45-9.mol |  |
| | (-)-Diisopropyl O,O'-bis(trimethylsilyl) -D-tartrate Chemical Properties |
| Boiling point | 105-107 °C1 mm Hg(lit.) | | density | 0.972 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.428(lit.) | | Fp | >230 °F | | form | solid | | Optical Rotation | [α]20/D -57°, c =1 in chloroform | | InChI | 1S/C16H34O6Si2/c1-11(2)19-15(17)13(21-23(5,6)7)14(22-24(8,9)10)16(18)20-12(3)4/h11-14H,1-10H3/t13-,14-/m0/s1 | | InChIKey | WTAZEIUCUCCYIA-KBPBESRZSA-N | | SMILES | CC(C)OC(=O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)OC(C)C |
| | (-)-Diisopropyl O,O'-bis(trimethylsilyl) -D-tartrate Usage And Synthesis |
| | (-)-Diisopropyl O,O'-bis(trimethylsilyl) -D-tartrate Preparation Products And Raw materials |
|