| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
Neopentyl glycol dimethylsulfate 97 manufacturers
|
| | Neopentyl glycol dimethylsulfate 97 Basic information |
| Product Name: | Neopentyl glycol dimethylsulfate 97 | | Synonyms: | (2,2-dimethyl-3-methylsulfonyloxypropyl) methanesulfonate;2,2-DIMETHYLPROPANE-1,3-DIYL DIMETHANESULFONATE;1,3-Propanediol, 2,2-dimethyl-, 1,3-dimethanesulfonate;Neopentyl glycol dimethylsulfate 97%;3-(methanesulfonyloxy)-2,2-dimethylpropyl methanesulfonate;2,2-Dimethyl-1,3-propanediol dimethylsulfate - [D73375];Neopentyl glycol dimethylsulfate 97 | | CAS: | 53555-41-2 | | MF: | C7H16O6S2 | | MW: | 260.33 | | EINECS: | | | Product Categories: | | | Mol File: | 53555-41-2.mol |  |
| | Neopentyl glycol dimethylsulfate 97 Chemical Properties |
| Melting point | 69-74 °C | | Boiling point | 457.8±28.0 °C(Predicted) | | density | 1.308±0.06 g/cm3(Predicted) | | storage temp. | 2-30°C | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C7H16O6S2/c1-7(2,5-12-14(3,8)9)6-13-15(4,10)11/h5-6H2,1-4H3 | | InChIKey | MBBDNGMNEVIICT-UHFFFAOYSA-N | | SMILES | CC(C)(COS(C)(=O)=O)COS(C)(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-36/39 | | WGK Germany | 2 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Dam. 1 |
| | Neopentyl glycol dimethylsulfate 97 Usage And Synthesis |
| | Neopentyl glycol dimethylsulfate 97 Preparation Products And Raw materials |
|