| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Diethyl 2-phthalimidomalonate-2-13C, 99 atom % 13C Basic information |
| | Diethyl 2-phthalimidomalonate-2-13C, 99 atom % 13C Chemical Properties |
| Melting point | 74-76 °C (lit.) | | form | solid | | InChI | 1S/C15H15NO6/c1-3-21-14(19)11(15(20)22-4-2)16-12(17)9-7-5-6-8-10(9)13(16)18/h5-8,11H,3-4H2,1-2H3/i11+1 | | InChIKey | SZNGBHWKVWEBKW-KHWBWMQUSA-N | | SMILES | CCOC(=O)[13CH](N1C(=O)c2ccccc2C1=O)C(=O)OCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Diethyl 2-phthalimidomalonate-2-13C, 99 atom % 13C Usage And Synthesis |
| | Diethyl 2-phthalimidomalonate-2-13C, 99 atom % 13C Preparation Products And Raw materials |
|