| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Copper(II) 4 4' 4'' 4'''-tetraaza-29h 3& Basic information |
| Product Name: | Copper(II) 4 4' 4'' 4'''-tetraaza-29h 3& | | Synonyms: | Copper(II) 4,4',4'',4'''-tetraaza-29H,31H-phthalocyanine;copper(ii) 4,4',4'',4'''-tetraaza-29H,31H-phthalo;Copper(II)4,4invertedexclamationmarka,4invertedexclamationmarkainvertedexclamationmarka,4invertedexclamationmarkainvertedexclamationmarkainvertedexclamationmarka-tetraaza-29H,31H-phthalocyanine;Copper(II) 4,4′,4′′,4′′′-tetraaza-29H,31H-phthalocyanine;Copper(II) 4 4' 4'' 4'''-tetraaza-29h 3& | | CAS: | 15275-52-2 | | MF: | C28H12CuN12 | | MW: | 580.02 | | EINECS: | | | Product Categories: | Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Phthalocyanines | | Mol File: | 15275-52-2.mol |  |
| | Copper(II) 4 4' 4'' 4'''-tetraaza-29h 3& Chemical Properties |
| form | solid | | InChIKey | VHJDNKDQMUHOKI-UHFFFAOYSA-N | | SMILES | [Cu]1n2c3nc4nc(nc5n1c(nc6nc(nc2c7cnccc37)c8cnccc68)c9cnccc59)c%10cnccc4%10 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Copper(II) 4 4' 4'' 4'''-tetraaza-29h 3& Usage And Synthesis |
| | Copper(II) 4 4' 4'' 4'''-tetraaza-29h 3& Preparation Products And Raw materials |
|