|
|
| | 2,3,4-Trifluorocinnamic acid Basic information |
| Product Name: | 2,3,4-Trifluorocinnamic acid | | Synonyms: | 3-(2,3,4-Trifluorophenyl)acrylic acid;2,3,4-Trifluorocinnamic acid;2 3 4-TRIFLUOROCINNAMIC ACID 99;3-(2,3,4-Trifluorophenyl)acrylic acid, 3-(2,3,4-Trifluorophenyl)prop-2-enoic acid;2,3,4-Trifluorocinnamicacid98%;2,3,4-Trifluorocinna;2-Propenoic acid, 3-(2,3,4-trifluorophenyl)-;2,3,4-Trifluorocinnamic acid USP/EP/BP | | CAS: | 207742-85-6 | | MF: | C9H5F3O2 | | MW: | 202.13 | | EINECS: | | | Product Categories: | Cinnamic acid | | Mol File: | 207742-85-6.mol |  |
| | 2,3,4-Trifluorocinnamic acid Chemical Properties |
| Melting point | 175-178 °C(lit.) | | Boiling point | 273.8±35.0 °C(Predicted) | | density | 1.468±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.13±0.15(Predicted) | | Appearance | Light yellow to light brown Solid | | InChI | InChI=1S/C9H5F3O2/c10-6-3-1-5(2-4-7(13)14)8(11)9(6)12/h1-4H,(H,13,14) | | InChIKey | AYDLBRHSHLRVAH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C=CC1=CC=C(F)C(F)=C1F | | CAS DataBase Reference | 207742-85-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2916399090 |
| | 2,3,4-Trifluorocinnamic acid Usage And Synthesis |
| | 2,3,4-Trifluorocinnamic acid Preparation Products And Raw materials |
|