|
|
| | Phenethyl glucosinolate potassium Basic information |
| Product Name: | Phenethyl glucosinolate potassium | | Synonyms: | Gluconasturtiin Potassium Salt Reference Standard, 95%;PHENETHYL GLUCOSINOLATE POTASSIUM(GLUCONASTURTIIN);Gluconasturtiin (potassium);Phenethyl glucosinolate potassium salt, Cytochrome P450 inhibitor;PHENETHYL GLUCOSINOLATE POTASSIUM SALT(GLUCONASTURTIIN);Phenethyl glucosinolate potassium | | CAS: | 18425-76-8 | | MF: | C15H20NO9S2.K | | MW: | 461.551 | | EINECS: | | | Product Categories: | | | Mol File: | 18425-76-8.mol |  |
| | Phenethyl glucosinolate potassium Chemical Properties |
| Melting point | 171℃ | | storage temp. | 2-8°C | | Major Application | food and beverages | | InChIKey | QWDORMZZPLRKAE-UHFFFAOYSA-M | | SMILES | [K+].[S](=O)(=O)([O-])ONC(=CCc2ccccc2)SC1OC(C(C(C1O)O)O)CO |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | Phenethyl glucosinolate potassium Usage And Synthesis |
| | Phenethyl glucosinolate potassium Preparation Products And Raw materials |
|