|
|
| | METHYL (S)-(-)-1-TRITYL-2-AZIRIDINE- Basic information |
| | METHYL (S)-(-)-1-TRITYL-2-AZIRIDINE- Chemical Properties |
| Melting point | 124-128 °C(lit.) | | Boiling point | 430.3±45.0 °C(Predicted) | | density | 1.195±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), DMSO (Slightly), Ethyl Acetate (Sparingly) | | pka | 2.57±0.40(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]23/D 88.6°, c = 1 in chloroform | | InChI | InChI=1S/C23H21NO2/c1-26-22(25)21-17-24(21)23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21H,17H2,1H3/t21-,24/m0/s1 | | InChIKey | QGSITPKXYQEFIR-XEGCMXMBSA-N | | SMILES | N1(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C[C@H]1C(OC)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | METHYL (S)-(-)-1-TRITYL-2-AZIRIDINE- Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Methyl (S)-N-Tritylaziridine-2-carboxylate (cas# 75154-68-6) is a compound useful in organic synthesis. | | Application | Methyl (S)-(-)-1-Trityl-2-aziridine is an important building block and intermediate in organic synthesis.
| | Hazard | Methyl (S)-(-)-1-Trityl2-aziridine causes eye irritation and skin irritation.
|
| | METHYL (S)-(-)-1-TRITYL-2-AZIRIDINE- Preparation Products And Raw materials |
|