| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | D-Glucose-1,2,3,4,5,6,6-d7 Basic information |
| Product Name: | D-Glucose-1,2,3,4,5,6,6-d7 | | Synonyms: | D-GLUCOSE1 2 3 4 5 6 6-D7 97-99 ATOM %&;D-GLUCOSE1,2,3,4,5,6,6-D7, 97-99 ATOM %D;d-glucose-1,2,3,4,5,6,6-d7atom%d;D-Glucose-C-d7, Dextrose-C-d7;Dextrose-C-d7;D-Glucose-1,2,3,4,5,6,6-D7;D-Glucose-1,2,3,4,5,6,6-d7 | | CAS: | 23403-54-5 | | MF: | C6H5D7O6 | | MW: | 187.2 | | EINECS: | | | Product Categories: | | | Mol File: | 23403-54-5.mol |  |
| | D-Glucose-1,2,3,4,5,6,6-d7 Chemical Properties |
| Melting point | 150-152 °C (dec) (lit.) | | Boiling point | 410.797±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.732±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Sparingly) | | form | Solid | | pka | 12.124±0.70(predicted) | | color | White to Off-White | | Optical Rotation | [α]25/D +52.0°, c = 2 in H2O (trace NH4OH) | | Stability: | Hygroscopic | | InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4-,5+,6/m0/s1/i1D2,2D,3D,4D,5D,6D | | InChIKey | WQZGKKKJIJFFOK-KMTOWNPSSA-N | | SMILES | [2H]C([2H])(O)[C@@]1([2H])OC([2H])(O)[C@]([2H])(O)[C@@]([2H])(O)[C@]1([2H])O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-Glucose-1,2,3,4,5,6,6-d7 Usage And Synthesis |
| Uses | Labelled D-Glucose is a simple sugar that is present in plants. A monosaccharide that may exist in open chain or cyclic conformation if in solution. It plays a vital role in photosynthesis and fuels the energy required for cellular respiration. D-Glucose is used in various metabolic processes including enzymic synthesis of cyclohexyl-α and β-D-glucosides. Can also be used as a diagnostic tool in detection of type 2 diabetes mellitus and potentially Huntington''s disease through analysis of blood-glucose in type 1 diabetes mellitus. |
| | D-Glucose-1,2,3,4,5,6,6-d7 Preparation Products And Raw materials |
|