| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 3-Amino-2-phenyl-4(3H)-quinazolinone Basic information |
| | 3-Amino-2-phenyl-4(3H)-quinazolinone Chemical Properties |
| Melting point | 176-179 °C(lit.) | | Boiling point | 434.5±28.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | pka | -1.65±0.20(Predicted) | | form | solid | | InChI | 1S/C14H11N3O/c15-17-13(10-6-2-1-3-7-10)16-12-9-5-4-8-11(12)14(17)18/h1-9H,15H2 | | InChIKey | YKBACEIGOHYXAC-UHFFFAOYSA-N | | SMILES | NN1C(=O)c2ccccc2N=C1c3ccccc3 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | DB7084000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Amino-2-phenyl-4(3H)-quinazolinone Usage And Synthesis |
| | 3-Amino-2-phenyl-4(3H)-quinazolinone Preparation Products And Raw materials |
|