1-(tert-Butyl)cyclopentyl Methacrylate manufacturers
|
| | 1-(tert-Butyl)cyclopentyl Methacrylate Basic information |
| Product Name: | 1-(tert-Butyl)cyclopentyl Methacrylate | | Synonyms: | 1-(tert-Butyl)cyclopentyl Methacrylate;2-Propenoic acid, 2-methyl-, 1-(1,1-dimethylethyl)cyclopentyl ester;2-Methyl-2-propenoic acid 1-(1,1-dimethylethyl)cyclopentyl ester;1-(1,1-Dimethylethyl)cyclopentyl 2-methyl-2-propenoate;TBCPMA | | CAS: | 1179475-19-4 | | MF: | C13H22O2 | | MW: | 210.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1179475-19-4.mol |  |
| | 1-(tert-Butyl)cyclopentyl Methacrylate Chemical Properties |
| Boiling point | 252.9±9.0 °C(Predicted) | | density | 0.93±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C13H22O2/c1-10(2)11(14)15-13(12(3,4)5)8-6-7-9-13/h1,6-9H2,2-5H3 | | InChIKey | IEYLGELMIWOKIN-UHFFFAOYSA-N | | SMILES | C(OC1(C(C)(C)C)CCCC1)(=O)C(C)=C |
| | 1-(tert-Butyl)cyclopentyl Methacrylate Usage And Synthesis |
| | 1-(tert-Butyl)cyclopentyl Methacrylate Preparation Products And Raw materials |
|