| Company Name: |
Accela ChemBio Co.,Ltd.
|
| Tel: |
021-50795510 4000665055 |
| Email: |
sales@accelachem.com |
| Products Intro: |
Product Name:1-[(Dimethylamino)methyl]cyclopropyl]methanol
CAS:39943-41-4
Purity:>=95% Package:0.1g;0.25g;1g;5g;10g;25g
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-66028182 18626450290 |
| Email: |
yftan@aikonchem.com |
| Products Intro: |
Product Name:(1-((Dimethylamino)methyl)cyclopropyl)methanol
CAS:39943-41-4
Purity:95+% Package:1g;5g;10g
|
|
| | {1-[(dimethylamino)methyl]cyclopropyl}methanol Basic information |
| | {1-[(dimethylamino)methyl]cyclopropyl}methanol Chemical Properties |
| Boiling point | 170.6±13.0 °C(Predicted) | | density | 0.981±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 15.10±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H15NO/c1-8(2)5-7(6-9)3-4-7/h9H,3-6H2,1-2H3 | | InChIKey | OCYZABOUZSORIT-UHFFFAOYSA-N | | SMILES | C1(CN(C)C)(CO)CC1 |
| | {1-[(dimethylamino)methyl]cyclopropyl}methanol Usage And Synthesis |
| | {1-[(dimethylamino)methyl]cyclopropyl}methanol Preparation Products And Raw materials |
|