| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DEXTROMETHORPHAN-D3 Basic information |
| | DEXTROMETHORPHAN-D3 Chemical Properties |
| Melting point | 105-110°C | | Fp | 9℃ | | storage temp. | -20°C Freezer | | solubility | Methanol (Soluble) | | form | Colourless Solution | | Major Application | forensics and toxicology | | InChI | 1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m1/s1/i1D3 | | InChIKey | MKXZASYAUGDDCJ-GQJJTUARSA-N | | SMILES | [2H]C([2H])([2H])N1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc4ccc(OC)cc34 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | DEXTROMETHORPHAN-D3 Usage And Synthesis |
| Chemical Properties | Colourless Solid | | Uses | A labelled Dextromethorphan. An antitussive drug. Orally active synthetic morphine analog. Analgesic (narcotic). | | General Description | Dextromethorphan, also known as DXM or DM, is an opiate cough suppressant also used recreationally as an illicit drug and hallucinogen. This stable labeled internal standard is suitable for numerous GC/MS and LC/MS applications from clinical toxicology, urine drug testing, and forensic analysis to pain management testing and isotope dilution methods. |
| | DEXTROMETHORPHAN-D3 Preparation Products And Raw materials |
|