| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Chlorophyll C2(SH) Basic information |
| Product Name: | Chlorophyll C2(SH) | | Synonyms: | Chlorophyll C2 (In Solution);Magnesate(1-),[21-methyl(21R)-3-[(1E)-2-carboxyethenyl]-3,4-didehydro-9,14-diethenyl-4,8,13,18-tetramethyl-20-oxo-21-phorbinecarboxylato(3-)-kN23,kN24,kN25,kN26]-, hydrogen (1:1), (SP-4-2)-;Chlorophyll C2(SH) | | CAS: | 27736-03-4 | | MF: | C35H28MgN4O5 | | MW: | 608.92562 | | EINECS: | | | Product Categories: | | | Mol File: | 27736-03-4.mol |  |
| | Chlorophyll C2(SH) Chemical Properties |
| storage temp. | -20°C | | SMILES | CC1=C(C=C2[N]3=C4C(/C=C/C(O)=O)=C2C)N5C(C=C6C(C)=C(C=C)C7=[N]6[Mg@@]53N8C(C(C)=C9C8=C4[C@@H](C(OC)=O)C9=O)=C7)=C1C=C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Chlorophyll C2(SH) Usage And Synthesis |
| | Chlorophyll C2(SH) Preparation Products And Raw materials |
|