4-Amino-N-(tert-butyl)benzamide manufacturers
|
| | 4-Amino-N-(tert-butyl)benzamide Basic information |
| Product Name: | 4-Amino-N-(tert-butyl)benzamide | | Synonyms: | N-tert-butyl-4-aminobenzamide;Benzamide, 4-amino-N-(1,1-dimethylethyl)-;N-(1,1-dimethylethyl)-4-amino-benzamide;4-AMINO-N-(TERT-BUTY;4-Amino-N-(tert-butyl)benzamide | | CAS: | 93483-71-7 | | MF: | C11H16N2O | | MW: | 192.26 | | EINECS: | 804-486-2 | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-Amino-N-(tert-butyl)benzamide Chemical Properties |
| Boiling point | 372.3±25.0 °C(Predicted) | | density | 1.058±0.06 g/cm3(Predicted) | | pka | 15.83±0.46(Predicted) | | InChI | InChI=1S/C11H16N2O/c1-11(2,3)13-10(14)8-4-6-9(12)7-5-8/h4-7H,12H2,1-3H3,(H,13,14) | | InChIKey | IBSCJDKXUQIEPQ-UHFFFAOYSA-N | | SMILES | C(NC(C)(C)C)(=O)C1=CC=C(N)C=C1 |
| | 4-Amino-N-(tert-butyl)benzamide Usage And Synthesis |
| Uses | 4-Amino-N-tert-butylbenzamide is an amide derivative that is widely used in pharmaceuticals, dyes, pesticides and other fields. | | Definition | ChEBI: 4-amino-n-(tert-butyl)benzamide is a member of benzamides. |
| | 4-Amino-N-(tert-butyl)benzamide Preparation Products And Raw materials |
|