|
|
| | 4-BROMO-2-CHLOROTHIOPHENE Basic information |
| | 4-BROMO-2-CHLOROTHIOPHENE Chemical Properties |
| Boiling point | 67-69 °C(Press: 9 Torr) | | density | 1.844±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C4H2BrClS/c5-3-1-4(6)7-2-3/h1-2H | | InChIKey | FEDTVFXCDOSSOK-UHFFFAOYSA-N | | SMILES | C1(Cl)SC=C(Br)C=1 |
| | 4-BROMO-2-CHLOROTHIOPHENE Usage And Synthesis |
| Uses | 4-Bromo-2-chlorothiophene is a thiophene derivative used in the preparation of potential hypolipidemic agents. |
| | 4-BROMO-2-CHLOROTHIOPHENE Preparation Products And Raw materials |
|