| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:3-(4-Methoxyphenyl)-2-phenyl-2-propenoic acid
CAS:6968-77-0
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Product Name:3-(4-Methoxyphenyl)-2-phenyl-2-propenoic acid
CAS:6968-77-0
|
| Company Name: |
OTAVA chemicals
|
| Tel: |
416 305 9979 (Canada) |
| Email: |
north.america@otavachemicals.com |
| Products Intro: |
|
|
| | OTAVA-BB BB7020252434 Basic information |
| Product Name: | OTAVA-BB BB7020252434 | | Synonyms: | OTAVA-BB BB7020252434;3-(4-Methoxyphenyl)-2-phenyl-2-propenoic acid;NSC 39459;NSC 638183;NSC 66265;alpha-[(4-Methoxyphenyl)methylene]benzeneacetic acid;(2E)-3-(4-Methoxyphenyl)-2-phenylacrylic acid;Benzeneacetic acid, α-[(4-methoxyphenyl)methylene]- | | CAS: | 6968-77-0 | | MF: | C16H14O3 | | MW: | 254.28 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | OTAVA-BB BB7020252434 Chemical Properties |
| Melting point | 189 °C | | Boiling point | 386.9±27.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | form | solid | | pka | 4.08±0.10(Predicted) | | InChI | 1S/C16H14O3/c1-19-14-9-7-12(8-10-14)11-15(16(17)18)13-5-3-2-4-6-13/h2-11H,1H3,(H,17,18)/b15-11+ | | InChIKey | NHUQYXSTNXLJIW-RVDMUPIBSA-N | | SMILES | O(C)c1ccc(cc1)\C=C(/c2ccccc2)\C(=O)O |
| Hazard Codes | Xn | | Risk Statements | 22 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | OTAVA-BB BB7020252434 Usage And Synthesis |
| | OTAVA-BB BB7020252434 Preparation Products And Raw materials |
|