|
|
| | 3,5-DI-TERT-BUTYLBENZYL BROMIDE Basic information |
| Product Name: | 3,5-DI-TERT-BUTYLBENZYL BROMIDE | | Synonyms: | 1-(Bromomethyl)-3,5-bis(1,1-dimethylethyl)benzene;a-Bromo-3,5-di-tert-butyltoluene;3,5-DI-TERT-BUTYLBENZYL BROMIDE;3,5-Tert-butylbenzyl bromide;ALPHA-BROMO-3,5-DI-TERT-BUTYLTOLUENE;1-bromomethyl-3,5-di-tert-butyl-benzene;Benzene, 1-(broMoMethyl)-3,5-bis(1,1-diMethylethyl)-;3,5-Di-tert-butylbenzyl broMide 97% | | CAS: | 62938-08-3 | | MF: | C15H23Br | | MW: | 283.25 | | EINECS: | | | Product Categories: | | | Mol File: | 62938-08-3.mol |  |
| | 3,5-DI-TERT-BUTYLBENZYL BROMIDE Chemical Properties |
| Melting point | 30 °C | | Boiling point | 108 °C(Press: 1 Torr) | | density | 1.122±0.06 g/cm3(Predicted) | | Fp | 34 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Almost white or Almost colorless | | FreezingPoint | 33.0 to 37.0 ℃ | | InChI | InChI=1S/C15H23Br/c1-14(2,3)12-7-11(10-16)8-13(9-12)15(4,5)6/h7-9H,10H2,1-6H3 | | InChIKey | SNRYBGHMHAJTTM-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | HS Code | 2903.99.8001 | | HazardClass | 8 | | PackingGroup | Ⅱ | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3,5-DI-TERT-BUTYLBENZYL BROMIDE Usage And Synthesis |
| Uses | Reactant involved in:
- Chemoselective trifluoromethylation
- Aralkylation of 2-N-acetylguanine
- Coupling reactions with terminal alkynes
- Synthesis of near-IR solid-state fluorescent naphthooxazine dyes
Reactant involved in synthesis of biologically active molecules including:
- Steroid sulfatase inhibitors
- Short cationic antimicrobial peptides
|
| | 3,5-DI-TERT-BUTYLBENZYL BROMIDE Preparation Products And Raw materials |
|