- Hexapeptide-10
-
-
2026-09-01
- CAS:146439-94-3
- Min. Order: 10g
- Purity: 99%
- Supply Ability: 10000g
|
| Product Name: | H-Ser-Ile-Lys-Val-Ala-Val-OH | | Synonyms: | SER-ILE-LYS-VAL-ALA-VAL;L-Seryl-L-isoleucyl-L-lysyl-L-valyl-L-alanyl-L-valine;L-Valine, L-seryl-L-isoleucyl-L-lysyl-L-valyl-L-alanyl-;Hexapeptide-10 (Silitide);H-SER-ILE-LYS-VAL-ALA-VAL-OH USP/EP/BP;Cosmetic Peptide Hexapeptide-10 Serilesine for Anti-Wrinkle & Anti-Aging CAS 146439-94-3;Peptide Hexapeptide-10/Serilesine;Hexapeptide-10, Serilesine, H-SER-ILE-LYS-VAL-ALA-VAL-OH | | CAS: | 146439-94-3 | | MF: | C28H53N7O8 | | MW: | 615.76 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | Mol File |  |
| | H-Ser-Ile-Lys-Val-Ala-Val-OH Chemical Properties |
| Boiling point | 1012.5±65.0 °C(Predicted) | | density | 1.176±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | pka | 3.36±0.10(Predicted) | | Cosmetics Ingredients Functions | HUMECTANT | | InChIKey | OFGVZFQUFJYSGS-CPDXTSBQSA-N | | SMILES | C(O)(=O)[C@H](C(C)C)NC(=O)[C@H](C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H](CO)N |
| | H-Ser-Ile-Lys-Val-Ala-Val-OH Usage And Synthesis |
| Physical Form | Solid | | Uses | Hexapeptide-10 is an amino acid derivative[1]. | | References | [1] Bell JD, et al. Conformationally rigid pyrazoloquinazoline α-amino acids: one- and two-photon induced fluorescence. Chem Commun (Camb). 2020 Feb 11;56(12):1887-1890. DOI:10.1039/c9cc09064a |
| | H-Ser-Ile-Lys-Val-Ala-Val-OH Preparation Products And Raw materials |
|