- 2-Fluoropropionic acid
-
- $2.20 / 100kg
-
2025-10-13
- CAS:6087-13-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | 2-FLUOROPROPIONIC ACID Basic information |
| | 2-FLUOROPROPIONIC ACID Chemical Properties |
| Boiling point | 66-67 °C/30 mmHg | | density | 1.181 g/mL at 25 °C | | refractive index | n20/D 1.383 | | Fp | 66-67°C/30mm | | storage temp. | Storage temp. 2-8°C | | solubility | Acetone (Sparingly), DMSO (Slightly), Methanol (Slightly) | | pka | 2.68±0.10(Predicted) | | form | liquid | | color | Clear, colourless | | Water Solubility | Partly miscible in water. | | InChI | InChI=1S/C3H5FO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6) | | InChIKey | ZVZPFTCEXIGSHM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(F)C | | CAS DataBase Reference | 6087-13-4(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN2922 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29159000 |
| | 2-FLUOROPROPIONIC ACID Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2-Fluoropropionic acid is used in the medical field for diagnostic purposes. It is labeled with 18F and is used as an imaging agent for detecting prostate cancer in humans. It is also used to prepare 2-fluoro fatty acids, compounds that exhibit antifungal properties. |
| | 2-FLUOROPROPIONIC ACID Preparation Products And Raw materials |
|