- BETA-D-LACTOSE
-
- $1.00
-
2019-08-08
- CAS:5965-66-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg,10kg,100kg
|
| | BETA-D-LACTOSE Basic information |
| | BETA-D-LACTOSE Chemical Properties |
| Melting point | 224 °C | | Boiling point | 397.76°C (rough estimate) | | density | 1.5900 | | refractive index | 1.5376 (estimate) | | RTECS | LZ5776360 | | storage temp. | Room Temp | | solubility | Water (Slightly) | | form | Solid | | pka | 12.02±0.70(Predicted) | | color | White to Off-White | | biological source | bovine milk | | Water Solubility | Soluble in water. | | Merck | 14,5343 | | InChI | 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1 | | InChIKey | GUBGYTABKSRVRQ-DCSYEGIMSA-N | | SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O | | CAS DataBase Reference | 5965-66-2(CAS DataBase Reference) | | EPA Substance Registry System | .beta.-D-Glucopyranose, 4-O-.beta.-D-galactopyranosyl- (5965-66-2) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 17021100 | | Storage Class | 11 - Combustible Solids |
| | BETA-D-LACTOSE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | β-D-Lactose is used in the pharmaceutical industry to make tablets. It acts as a nutrient and as a filler used in pills. It is utilized in the dilution of heroin. Further, it is used to sweeten stout beer. | | Definition | ChEBI: The beta-anomer of lactose. | | Biochem/physiol Actions | Beta-Lactose is the beta-pyranose form of the compound lactose. |
| | BETA-D-LACTOSE Preparation Products And Raw materials |
|