2-Cyano-3-morpholinoacrylamide manufacturers
- Cicrotoic acid
-
- $0.00 / 25KG
-
2025-12-01
- CAS:25229-97-4
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10000KG
|
| | 2-Cyano-3-morpholinoacrylamide Basic information |
| Product Name: | 2-Cyano-3-morpholinoacrylamide | | Synonyms: | 2-CYANO-3-MORPHOLINOACRYLAMIDE;3-Morpholino-2-cyanoacrylamide;3-MORPHOLINE-2-CYANOACYLAMIDE;2-CYANO-3-MORPHOLINOACRYLAMIDE 98%;2-Cyano-3-morpholin-4-ylprop-2-enamide;2-Propenamide, 2-cyano-3-(4-morpholinyl)-;2-CYANO-3-MORPHOLINOACRYLAMIDE, 98%, PURE;2-Cyano-3-morpholinoacrylamide, pure | | CAS: | 25229-97-4 | | MF: | C8H11N3O2 | | MW: | 181.19 | | EINECS: | 246-741-5 | | Product Categories: | | | Mol File: | 25229-97-4.mol |  |
| | 2-Cyano-3-morpholinoacrylamide Chemical Properties |
| Melting point | 173-177 °C | | Boiling point | 314.3°C (rough estimate) | | density | 1.2444 (rough estimate) | | refractive index | 1.7400 (estimate) | | pka | 12.73±0.50(Predicted) | | InChI | InChI=1S/C8H11N3O2/c9-5-7(8(10)12)6-11-1-3-13-4-2-11/h6H,1-4H2,(H2,10,12) | | InChIKey | LLKCXVWITGBXLG-UHFFFAOYSA-N | | SMILES | C(N)(=O)C(C#N)=CN1CCOCC1 |
| | 2-Cyano-3-morpholinoacrylamide Usage And Synthesis |
| Chemical Properties | light yellow crystalline powder |
| | 2-Cyano-3-morpholinoacrylamide Preparation Products And Raw materials |
|