|
|
| | 2-Methoxyphenothiazine Basic information |
| | 2-Methoxyphenothiazine Chemical Properties |
| Melting point | 185-188°C | | Boiling point | 408.1±34.0 °C(Predicted) | | density | 1.235±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO, Methanol (Slightly) | | form | Solid | | pka | -1.32±0.20(Predicted) | | color | Pale Grey to Pale Brown | | InChI | InChI=1S/C13H11NOS/c1-15-9-6-7-13-11(8-9)14-10-4-2-3-5-12(10)16-13/h2-8,14H,1H3 | | InChIKey | DLYKFPHPBCTAKD-UHFFFAOYSA-N | | SMILES | C1=C2C(SC3=C(N2)C=CC=C3)=CC=C1OC | | CAS DataBase Reference | 1771-18-2(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Methoxyphenothiazine(1771-18-2) |
| | 2-Methoxyphenothiazine Usage And Synthesis |
| Chemical Properties | Yellow or pale gray solid | | Uses | An impurity of Methotrimeprazine (M260785).A derivative of Phenothiazine (P318040) exhibits tuberculostatic activity. | | Uses | An Impurity of Methotrimeprazine (M260785).
A derivative of Phenothiazine (P318040) exhibits tuberculostatic activity. | | Definition | ChEBI: 2-methoxy-10H-phenothiazine is a member of phenothiazines. |
| | 2-Methoxyphenothiazine Preparation Products And Raw materials |
|